CymitQuimica logo

CAS 877-42-9

:

6-Bromo-2-methylquinoline

Description:
6-Bromo-2-methylquinoline is an organic compound characterized by its quinoline structure, which consists of a fused benzene and pyridine ring. The presence of a bromine atom at the 6-position and a methyl group at the 2-position contributes to its unique chemical properties. This compound typically appears as a yellow to brown solid and is known for its moderate solubility in organic solvents such as ethanol and dichloromethane, while being less soluble in water. It exhibits interesting reactivity due to the electron-withdrawing nature of the bromine atom, which can influence its behavior in electrophilic substitution reactions. Additionally, 6-bromo-2-methylquinoline can serve as a building block in the synthesis of various pharmaceuticals and agrochemicals, owing to its potential biological activity. Its derivatives may exhibit antimicrobial, anti-inflammatory, or anticancer properties, making it a subject of interest in medicinal chemistry. Safety precautions should be taken when handling this compound, as with many halogenated organic substances, due to potential toxicity and environmental concerns.
Formula:C10H8BrN
InChI:InChI=1/C10H8BrN/c1-7-2-3-8-6-9(11)4-5-10(8)12-7/h2-6H,1H3
InChI key:InChIKey=SQRYQSKJZVQJAY-UHFFFAOYSA-N
SMILES:Cc1ccc2cc(ccc2n1)Br
Synonyms:
  • 2-Methyl-6-bromoquinoline
  • 6-Bromoquinaldine
  • Quinaldine, 6-bromo-
  • Quinoline, 6-bromo-2-methyl-
Found 8 products.