CymitQuimica logo

CAS 877041-47-9

:

2-amino-6-(tert-butoxycarbonyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid

Description:
2-amino-6-(tert-butoxycarbonyl)-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-3-carboxylic acid is a chemical compound characterized by its complex bicyclic structure, which includes a thieno[2,3-c]pyridine core. This compound features an amino group and a carboxylic acid functional group, contributing to its potential as an intermediate in pharmaceutical synthesis. The tert-butoxycarbonyl (Boc) group serves as a protective group for the amino functionality, enhancing the compound's stability and reactivity during chemical transformations. The presence of the tetrahydro configuration indicates that the compound is saturated, which may influence its solubility and biological activity. This compound is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the design of compounds targeting specific biological pathways. Its CAS number, 877041-47-9, allows for precise identification in chemical databases and literature. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical properties, making it a valuable subject of study in organic and medicinal chemistry.
Formula:C14H20N2O4S
InChI:InChI=1/C14H20N2O4S/c1-14(2,3)20-13(18)16-6-5-8-9(7-16)21-11(15)10(8)12(17)19-4/h5-7,15H2,1-4H3
InChI key:LGHKBJKZINPCMI-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCc2c(C1)sc(c2C(=O)OC)N
Synonyms:
  • 6-tert-butyl 3-methyl 2-amino-4,7-dihydrothieno[2,3-c]pyridine-3,6(5H)-dicarboxylate
Found 4 products.