CymitQuimica logo

CAS 877149-06-9

:

4-Bromo-2-chloro-6-methylbenzonitrile

Description:
4-Bromo-2-chloro-6-methylbenzonitrile is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a bromine atom, a chlorine atom, and a methyl group, along with a nitrile functional group. The presence of these substituents influences its chemical properties, such as reactivity and polarity. The bromine and chlorine atoms are halogens, which can enhance the compound's electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. The nitrile group (-C≡N) contributes to the compound's overall polarity and can participate in further chemical transformations. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its physical properties, such as melting point, boiling point, and solubility, can vary based on the specific conditions and purity of the substance. Safety precautions should be taken when handling this compound, as it may pose health risks due to the presence of halogens and the nitrile group.
Formula:C8H5BrClN
InChI:InChI=1S/C8H5BrClN/c1-5-2-6(9)3-8(10)7(5)4-11/h2-3H,1H3
InChI key:InChIKey=YVQWFIMVHUBWJE-UHFFFAOYSA-N
SMILES:C(#N)C1=C(C)C=C(Br)C=C1Cl
Synonyms:
  • Benzonitrile, 4-bromo-2-chloro-6-methyl-
  • 4-Bromo-2-chloro-6-methylbenzonitrile
Found 3 products.