CAS 877160-63-9

3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline

Description:

3-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline is an organic compound characterized by its aromatic amine structure, which includes a chloro substituent and a boron-containing moiety. The presence of the chloro group enhances its reactivity, making it suitable for various synthetic applications, particularly in the field of medicinal chemistry and materials science. The tetramethyl-1,3,2-dioxaborolane group contributes to its unique properties, including potential applications in cross-coupling reactions, such as Suzuki coupling, due to the boron atom's ability to form stable complexes with other reagents. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties and reactivity. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken due to potential toxicity associated with amines and halogenated compounds.

Formula: C₁₂H₁₇BClNO₂

InChI: InChI=1/C12H17BClNO2/c1-11(2)12(3,4)17-13(16-11)9-6-5-8(15)7-10(9)14/h5-7H,15H2,1-4H3

SMILES: CC1(C)C(C)(C)OB(c2ccc(cc2Cl)N)O1

4-Amino-2-chlorophenylboronic acid, pinacol ester

CAS: 877160-63-9

Formula: C₁₂H₁₇BClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 253.5329

Ref: IN-DA004NBO

4-Amino-2-chlorophenylboronic acid, pinacol ester

CAS: 877160-63-9

4-Amino-2-chlorophenylboronic acid, pinacol ester

Purity: 99%

Molecular weight: 253.53g/mol

Ref: 54-OR360088

4-Amino-2-chlorophenylboronic acid pinacol ester

CAS: 877160-63-9

4-Amino-2-chlorophenylboronic acid pinacol ester is a versatile building block that is used in the synthesis of complex compounds. It can be used as a research chemical, reagent, or speciality chemical depending on the desired use. 4-Amino-2-chlorophenylboronic acid pinacol ester reacts with nucleophiles to form covalent bonds and is also useful as a scaffold for synthesizing other compounds. This compound has been shown to be useful in the synthesis of many different types of chemicals.

Formula: C₁₂H₁₇BClNO₂

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 253.53 g/mol

Ref: 3D-FA160875

3-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline

CAS: 877160-63-9

Formula: C₁₂H₁₇BClNO₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 253.53

Ref: 10-F212099