CymitQuimica logo

CAS 877160-63-9

:

3-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline

Description:
3-Chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline is an organic compound characterized by its aromatic amine structure, which includes a chloro substituent and a boron-containing moiety. The presence of the chloro group enhances its reactivity, making it suitable for various synthetic applications, particularly in the field of medicinal chemistry and materials science. The tetramethyl-1,3,2-dioxaborolane group contributes to its unique properties, including potential applications in cross-coupling reactions, such as Suzuki coupling, due to the boron atom's ability to form stable complexes with other reagents. This compound is typically solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests it may participate in hydrogen bonding and other intermolecular interactions, influencing its physical properties and reactivity. Safety data should be consulted for handling, as with any chemical, to ensure proper precautions are taken due to potential toxicity associated with amines and halogenated compounds.
Formula:C12H17BClNO2
InChI:InChI=1/C12H17BClNO2/c1-11(2)12(3,4)17-13(16-11)9-6-5-8(15)7-10(9)14/h5-7H,15H2,1-4H3
InChI key:YKQXROMICPMQBZ-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2ccc(cc2Cl)N)O1
Found 5 products.