CymitQuimica logo

CAS 87720-54-5

:

Boc-4,5-dehydro-Leu-OH . DCHA

Description:
Boc-4,5-dehydro-Leu-OH·DCHA, with the CAS number 87720-54-5, is a chemical compound that features a protected form of the amino acid leucine. The "Boc" (tert-butyloxycarbonyl) group serves as a protective moiety, which is commonly used in peptide synthesis to prevent unwanted reactions at the amino group. The "4,5-dehydro" designation indicates that the compound contains a double bond between the fourth and fifth carbon atoms of the leucine side chain, which can influence its reactivity and biological properties. The presence of DCHA (dihydrochloride salt) suggests that the compound is in a salt form, which can enhance its solubility in polar solvents. This compound is often utilized in the field of organic chemistry and peptide synthesis, particularly in the development of pharmaceuticals and biologically active compounds. Its unique structural features make it valuable for studying peptide interactions and modifications. As with many chemical substances, proper handling and safety precautions should be observed due to potential hazards associated with its use.
Formula:C23H42N2O4
InChI:InChI=1/C12H23N.C11H19NO4/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-7(2)6-8(9(13)14)12-10(15)16-11(3,4)5/h11-13H,1-10H2;8H,1,6H2,2-5H3,(H,12,15)(H,13,14)/t;8-/m.0/s1
InChI key:ZRIOKRZSXPPREV-WDBKTSHHSA-N
SMILES:C1CCC(CC1)NC1CCCCC1.C=C(C)C[C@@H](C(=O)O)N=C(O)OC(C)(C)C
Synonyms:
  • N-(tert-butoxycarbonyl)-4-methylidene-L-norvaline - N-cyclohexylcyclohexanamine (1:1)
Found 3 products.