CymitQuimica logo

CAS 877264-73-8

:

1H-Indazole-1-carboxylic acid, 5-acetyl-, 1,1-dimethylethyl ester

Description:
1H-Indazole-1-carboxylic acid, 5-acetyl-, 1,1-dimethylethyl ester is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features a carboxylic acid functional group that is esterified with a tert-butyl group, contributing to its lipophilicity and stability. The presence of an acetyl group at the 5-position enhances its reactivity and potential for further chemical modifications. The compound is likely to exhibit properties typical of indazole derivatives, including potential biological activity, which may include anti-inflammatory or anticancer effects, although specific biological data would need to be referenced for confirmation. Its molecular structure suggests it may be soluble in organic solvents and exhibit moderate stability under standard laboratory conditions. As with many organic compounds, proper handling and safety precautions should be observed due to potential toxicity or reactivity.
Formula:C14H16N2O3
InChI:InChI=1S/C14H16N2O3/c1-9(17)10-5-6-12-11(7-10)8-15-16(12)13(18)19-14(2,3)4/h5-8H,1-4H3
InChI key:WGOQOVURHJQHAF-UHFFFAOYSA-N
SMILES:CC(=O)C1=CC2=C(C=C1)N(N=C2)C(=O)OC(C)(C)C
Found 3 products.