CAS 87733-67-3

Ginsenoside Rs1

Description:

Ginsenoside Rs1 is a natural compound classified as a triterpenoid saponin, primarily derived from ginseng, particularly Panax ginseng. It is known for its potential pharmacological properties, including anti-inflammatory, antioxidant, and neuroprotective effects. Ginsenoside Rs1 exhibits a complex molecular structure characterized by a steroid-like backbone with various sugar moieties attached, which contribute to its biological activity. The compound is often studied for its role in enhancing cognitive function and its potential therapeutic effects in various diseases, including neurodegenerative disorders. Additionally, ginsenosides, including Rs1, are believed to modulate various signaling pathways in the body, influencing cellular processes such as apoptosis and immune response. Due to its bioactive nature, Ginsenoside Rs1 is of significant interest in both traditional medicine and modern pharmacology, with ongoing research aimed at elucidating its mechanisms of action and potential applications in health and disease management.

Formula: C₅₅H₉₂O₂₃

InChI: InChI=1S/C55H92O23/c1-24(2)11-10-15-55(9,78-49-45(69)41(65)39(63)31(75-49)23-72-47-43(67)36(60)28(59)21-71-47)26-12-17-54(8)35(26)27(58)19-33-52(6)16-14-34(51(4,5)32(52)13-18-53(33,54)7)76-50-46(42(66)37(61)29(20-56)73-50)77-48-44(68)40(64)38(62)30(74-48)22-70-25(3)57/h11,26-50,56,58-69H,10,12-23H2,1-9H3

InChI key: InChIKey=HAJTYGKLQDXTPO-UHFFFAOYSA-N

SMILES: CC12C3(C)C(C4(C)C(CC3)C(C)(C)C(OC5C(OC6OC(COC(C)=O)C(O)C(O)C6O)C(O)C(O)C(CO)O5)CC4)CC(O)C1C(C(OC7OC(COC8C(O)C(O)C(O)CO8)C(O)C(O)C7O)(CCC=C(C)C)C)CC2

Synonyms:

• β-D-Glucopyranoside, (3β,12β)-20-[(6-O-α-L-arabinopyranosyl-β-D-glucopyranosyl)oxy]-12-hydroxydammar-24-en-3-yl 2-O-(6-O-acetyl-β-D-glucopyranosyl)-
• Ginsenoside Rs1
• (3β,12β)-20-[(6-O-α-L-Arabinopyranosyl-β-D-glucopyranosyl)oxy]-12-hydroxydammar-24-en-3-yl 2-O-(6-O-acetyl-β-D-glucopyranosyl)-β-D-glucopyranoside
• Dammarane, β-D-glucopyranoside deriv.

Ginsenoside Rs1

CAS: 87733-67-3

Ginsenoside Rs1

Molecular weight: 1120.6

Ref: 10-F562751

Ginsenoside Rs1

CAS: 87733-67-3

Ginsenoside Rs1

Formula: C₅₅H₉₂O₂₃

Purity: ≥98%

Molecular weight: 1121.31

Ref: 54-OR1139361

Ginsenoside Rs1

CAS: 87733-67-3

Formula: C₅₅H₉₂O₂₃

Purity: 95%~99%

Molecular weight: 1121.32

Ref: BP-BP4526

Ginsenoside Rs1 (Standard)

CAS: 87733-67-3

Ginsenoside Rs1 (Standard) is a reference standard for research and analysis in studies involving Ginsenoside Rs1. Ginsenoside Rs1, extracted from the root of Panax ginseng ^[1], is a chemical compound with potential pharmacological properties.

Formula: C₅₅H₉₂O₂₃

Molecular weight: 1121.31

Ref: TM-TMSM-2706

Ginsenoside Rs1

CAS: 87733-67-3

Formula: C₅₅H₉₂O₂₃

Color and Shape: Solid

Molecular weight: 1121.3

Ref: BE-RMT11180

Ginsenoside RS1

CAS: 87733-67-3

Ginsenoside RS1 is a triterpenoid saponin, which is a secondary metabolite derived from the roots of the Panax ginseng plant, a member of the Araliaceae family. This natural compound exerts its effects through modulation of various cellular pathways, including antioxidative, anti-inflammatory, and possible apoptosis-inducing mechanisms. As a ginsenoside, RS1 impacts cellular environments by influencing signal transduction pathways, contributing to its pharmacokinetic and pharmacodynamic profile.

Formula: C₅₅H₉₂O₂₃

Purity: Min. 95%

Molecular weight: 1,121.3 g/mol

Ref: 3D-MDA73367