
CAS 87741-77-3
:Notoginsenoside R4
Description:
Notoginsenoside R4 is a saponin compound primarily derived from the roots of Panax notoginseng, a traditional medicinal plant known for its various health benefits. This compound is characterized by its complex glycosidic structure, which contributes to its biological activity. Notoginsenoside R4 exhibits anti-inflammatory, antioxidant, and neuroprotective properties, making it of interest in pharmacological research. It is often studied for its potential effects on cardiovascular health and its ability to enhance cognitive function. The compound is soluble in organic solvents and has limited solubility in water, which can influence its bioavailability and therapeutic applications. Additionally, Notoginsenoside R4 is recognized for its role in modulating various signaling pathways, thereby impacting cellular processes. Its safety profile and efficacy are subjects of ongoing research, particularly in the context of traditional medicine and modern therapeutic approaches. Overall, Notoginsenoside R4 represents a significant area of interest in natural product chemistry and pharmacology.
Formula:C59H100O27
InChI:InChI=1S/C59H100O27/c1-24(2)10-9-14-59(8,86-53-48(76)43(71)40(68)31(83-53)23-79-51-46(74)42(70)39(67)30(82-51)22-78-50-45(73)36(64)27(63)21-77-50)25-11-16-58(7)35(25)26(62)18-33-56(5)15-13-34(55(3,4)32(56)12-17-57(33,58)6)84-54-49(44(72)38(66)29(20-61)81-54)85-52-47(75)41(69)37(65)28(19-60)80-52/h10,25-54,60-76H,9,11-23H2,1-8H3/t25-,26+,27+,28+,29+,30+,31+,32-,33+,34-,35-,36-,37+,38+,39+,40+,41-,42-,43-,44-,45+,46+,47+,48+,49+,50-,51+,52-,53-,54-,56-,57+,58+,59-/m0/s1
InChI key:InChIKey=IWDYQBDCEDNTDP-BHPIZNGBSA-N
SMILES:C[C@]12[C@@]([C@]3(C)[C@@](CC1)(C(C)(C)[C@@H](O[C@H]4[C@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)[C@@H](O)[C@H](O)[C@@H](CO)O4)CC3)[H])(C[C@@H](O)[C@]6([C@@]2(C)CC[C@@]6([C@@](O[C@@H]7O[C@H](CO[C@@H]8O[C@H](CO[C@H]9[C@H](O)[C@@H](O)[C@H](O)CO9)[C@@H](O)[C@H](O)[C@H]8O)[C@@H](O)[C@H](O)[C@H]7O)(CCC=C(C)C)C)[H])[H])[H]
Synonyms:- Notoginsenoside R4
- β-D-Glucopyranoside, (3β,12β)-12-hydroxy-20-[(O-β-D-xylopyranosyl-(1→6)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-
- (3β,12β)-12-Hydroxy-20-[(O-β-D-xylopyranosyl-(1→6)-O-β-D-glucopyranosyl-(1→6)-β-D-glucopyranosyl)oxy]dammar-24-en-3-yl 2-O-β-D-glucopyranosyl-β-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Notoginsenoside R4
CAS:Notoginsenoside R4, a ginsenoside from Panax notoginseng, binds STAT3, AKT1, VEGFA, and CASP3, demonstrating anticancer and pro-apoptotic signaling modulation.Formula:C59H100O27Purity:99.77%Color and Shape:SolidMolecular weight:1241.42Notoginsenoside R4
CAS:Notoginsenoside R4 is a bioactive compound, which is a saponin extracted from the roots of Panax notoginseng. This herb, which is a member of the Araliaceae family, is renowned in traditional Chinese medicine for its wide range of pharmacological properties. Notoginsenoside R4 acts primarily by modulating various signaling pathways and demonstrating antioxidant, anti-inflammatory, and neuroprotective effects. It influences cellular mechanisms such as apoptosis and angiogenesis, which are critical in disease pathogenesis and treatment.Formula:C59H100O27Purity:Min. 95%Molecular weight:1,241.4 g/mol


