CAS 877617-45-3
:F-AMidine
Description:
F-AMidine, with the CAS number 877617-45-3, is a chemical compound characterized by its amidine functional group, which typically consists of a carbon atom double-bonded to a nitrogen atom and single-bonded to another nitrogen atom. This structure imparts unique reactivity and properties, making amidines valuable in various chemical applications, including pharmaceuticals and agrochemicals. F-AMidine may exhibit properties such as solubility in polar solvents, potential basicity due to the presence of nitrogen atoms, and the ability to form hydrogen bonds. Its specific characteristics, such as melting point, boiling point, and reactivity, would depend on its molecular structure and substituents. As with many chemical substances, safety data sheets should be consulted for handling and storage guidelines, as amidines can vary in toxicity and stability. Overall, F-AMidine represents a class of compounds with diverse applications in synthetic chemistry and medicinal research.
Formula:C14H19FN4O2
InChI:InChI=1S/C14H19FN4O2/c15-9-12(16)18-8-4-7-11(13(17)20)19-14(21)10-5-2-1-3-6-10/h1-3,5-6,11H,4,7-9H2,(H2,16,18)(H2,17,20)(H,19,21)/t11-/m0/s1
InChI key:OLFDULIIJWCYCK-NSHDSACASA-N
SMILES:C1=CC=C(C=C1)C(=O)N[C@@H](CCCN=C(CF)N)C(=O)N
Synonyms:- F-AMidine
- N-[(1S)-1-(AMinocarbonyl)-4-[(2-fluoro-1-iMinoethyl)aMino]butyl]benzaMide
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
F-amidine
CAS:F-amidine is a bioavailable irreversible PAD4 inactivator.Formula:C14H19FN4O2Color and Shape:SolidMolecular weight:294.32
