CymitQuimica logo

CAS 877624-38-9

:

3-Pyridinecarboxylic acid, 5-(bromomethyl)-, methyl ester

Description:
3-Pyridinecarboxylic acid, 5-(bromomethyl)-, methyl ester, identified by its CAS number 877624-38-9, is an organic compound characterized by the presence of a pyridine ring, a carboxylic acid functional group, and a methyl ester moiety. This compound features a bromomethyl group at the 5-position of the pyridine ring, which can influence its reactivity and potential applications in organic synthesis. The methyl ester group enhances its solubility in organic solvents and may facilitate various chemical reactions, such as esterification or nucleophilic substitution. The presence of the bromine atom introduces a halogen, which can serve as a leaving group in reactions, making the compound useful in the synthesis of more complex molecules. Additionally, the pyridine ring contributes to the compound's aromaticity and potential biological activity, as pyridine derivatives are often explored for their pharmacological properties. Overall, this compound's unique structure and functional groups make it a valuable intermediate in chemical research and development.
Formula:C8H8BrNO2
InChI:InChI=1S/C8H8BrNO2/c1-12-8(11)7-2-6(3-9)4-10-5-7/h2,4-5H,3H2,1H3
InChI key:AEZXIAKNBQNDPO-UHFFFAOYSA-N
SMILES:COC(=O)C1=CN=CC(=C1)CBr
Found 5 products.