CymitQuimica logo

CAS 87776-77-0

:

Benzeneethanol,4-methoxy-3-methyl-

Description:
Benzeneethanol, 4-methoxy-3-methyl- is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with both a methoxy group and a methyl group. This compound typically exhibits properties associated with aromatic alcohols, such as moderate solubility in organic solvents and limited solubility in water due to the hydrophobic nature of the benzene ring. The presence of the methoxy group enhances its reactivity and can influence its physical properties, such as boiling and melting points. Additionally, the compound may exhibit various functional properties, including potential applications in the synthesis of other organic compounds or as a fragrance component due to its pleasant aroma. Its molecular structure suggests that it may participate in hydrogen bonding, affecting its interactions with other substances. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance. Overall, Benzeneethanol, 4-methoxy-3-methyl- is a compound of interest in organic chemistry and related fields.
Formula:C10H14O2
InChI:InChI=1S/C10H14O2/c1-8-7-9(5-6-11)3-4-10(8)12-2/h3-4,7,11H,5-6H2,1-2H3
InChI key:PWCJNLPJZLJFPT-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)CCO)OC
Synonyms:
  • Phenethylalcohol, 4-methoxy-3-methyl- (7CI)
  • 2-(4-Methoxy-3-methylphenyl)ethanol
Found 2 products.