CAS 877822-40-7

Eupalinolide B

Description:

Eupalinolide B is a natural compound classified as a sesquiterpene lactone, which is known for its diverse biological activities. It is derived from certain plant species, particularly those in the Asteraceae family. The molecular structure of Eupalinolide B features a characteristic lactone ring, contributing to its reactivity and potential pharmacological properties. This compound has garnered interest in the field of medicinal chemistry due to its reported anti-inflammatory, antimicrobial, and cytotoxic effects against various cancer cell lines. Eupalinolide B's mechanism of action may involve the modulation of signaling pathways related to inflammation and cell proliferation. Additionally, its unique structural features may allow for further derivatization, enhancing its therapeutic potential. As with many natural products, the extraction and purification processes are critical for obtaining Eupalinolide B in sufficient quantities for research and potential applications. Overall, Eupalinolide B represents a promising candidate for further investigation in drug development and natural product chemistry.

Formula: C₂₄H₃₀O₉

InChI: InChI=1S/C24H30O9/c1-13(8-9-25)23(28)32-21-11-18(12-30-16(4)26)6-7-19(31-17(5)27)14(2)10-20-22(21)15(3)24(29)33-20/h6,8,10,19-22,25H,3,7,9,11-12H2,1-2,4-5H3/b13-8+,14-10-,18-6+/t19-,20+,21+,22-/m0/s1

InChI key: HPWMABTYJYZFLK-IAQZCCQJSA-N

SMILES: C/C/1=C/[C@@H]2[C@@H]([C@@H](C/C(=C\C[C@@H]1OC(=O)C)/COC(=O)C)OC(=O)/C(=C/CO)/C)C(=C)C(=O)O2

Synonyms:

• 2-Butenoic acid, 4-hydroxy-2-methyl-, (3aR,4R,6Z,9S,10Z,11aR)-9-(acetyloxy)-6-[(acetyloxy)methyl]-2,3,3a,4,5,8,9,11a-octahydro-10-methyl-3-methylene-2-oxocyclodeca[b]furan-4-yl ester, (2E)-
• EupalinolideB

Eupalinolide A

CAS: 877822-40-7

Eupalinolide A

Formula: C₂₄H₃₀O₉

Purity: ≥98%

Molecular weight: 462.49

Ref: 54-BUP02275

Eupalinolide A

CAS: 877822-40-7

Formula: C₂₄H₃₀O₉

Molecular weight: 462.50

Ref: 7W-GY8160

(3aR,4R,6Z,9S,10Z,11aR)-9-Acetoxy-6-(acetoxymethyl)-10-methyl-3-methylene-2-oxo-2,3,3a,4,5,8,9,11a-octahydrocyclodeca[b]furan-4-yl (E)-4-hydroxy-2-methylbut-2-enoate

CAS: 877822-40-7

Purity: 99%

Ref: IN-DA00H09S

Eupalinolide A

CAS: 877822-40-7

Formula: C₂₄H₃₀O₉

Purity: 95%~99%

Molecular weight: 462.495

Ref: BP-BP0574

Eupalinolide A

CAS: 877822-40-7

Eupalinolide B is a natural product ,and demonstrates potent cytotoxicity against A-549, BGC-823, SMMC-7721, and HL-60 tumour cell lines.

Formula: C₂₄H₃₀O₉

Purity: 98.82% - 99.22%

Color and Shape: Solid

Molecular weight: 462.4896

Ref: TM-T5826

Eupalinolide A

CAS: 877822-40-7

(3aR,4R,6Z,9S,10Z,11aR)-9-Acetoxy-6-(acetoxymethyl)-10-methyl-3-methylene-2-oxo-2,3,3a,4,5,8,9,11a-octahydrocyclodeca[b]furan-4-yl (E)-4-hydroxy-2-methylbut-2-enoate

Formula: C₂₄H₃₀O₉

Purity: 99%

Molecular weight: 462.49

Ref: IN-DG00768000

Eupalinolide A

CAS: 877822-40-7

Eupalinolide A is a sesquiterpene lactone that is extracted from Eupatorium. It has been shown to have anti-inflammatory and antioxidant properties, as well as the ability to activate caspase-9 in cells. This drug also inhibits the production of reactive oxygen species (ROS) by inhibiting mitochondrial membrane potential, which leads to cell death. Eupalinolide A also has the ability to inhibit collagen synthesis and can be used for the treatment of chronic bronchitis, hepatitis, and liver cirrhosis.

Formula: C₂₄H₃₀O₉

Purity: Min. 95%

Molecular weight: 462.49 g/mol

Ref: 3D-FE73986