CymitQuimica logo

CAS 877822-41-8

:

Eupalinolide A

Description:
Eupalinolide A is a natural compound classified as a sesquiterpene lactone, which is known for its complex structure and potential biological activities. It is derived from certain plant species, particularly those in the Asteraceae family. The compound exhibits a unique bicyclic structure, contributing to its diverse chemical properties. Eupalinolide A has garnered interest in the field of medicinal chemistry due to its reported anti-inflammatory, antimicrobial, and cytotoxic activities, making it a candidate for further pharmacological studies. Its mechanism of action and specific interactions at the molecular level are subjects of ongoing research. Additionally, the compound's stability, solubility, and reactivity can vary based on environmental conditions and the presence of other substances. As with many natural products, the extraction and purification processes are crucial for obtaining Eupalinolide A in sufficient quantities for research and potential therapeutic applications. Overall, Eupalinolide A represents a fascinating area of study within natural product chemistry and its implications in drug discovery.
Formula:C24H30O9
InChI:InChI=1S/C24H30O9/c1-13(8-9-25)23(28)32-21-11-18(12-30-16(4)26)6-7-19(31-17(5)27)14(2)10-20-22(21)15(3)24(29)33-20/h6,8,10,19-22,25H,3,7,9,11-12H2,1-2,4-5H3/b13-8+,14-10+,18-6-/t19-,20+,21+,22-/m0/s1
InChI key:HPWMABTYJYZFLK-FHEQDPKSSA-N
SMILES:C/C/1=C\[C@@H]2[C@@H]([C@@H](C/C(=C/C[C@@H]1OC(=O)C)/COC(=O)C)OC(=O)/C(=C/CO)/C)C(=C)C(=O)O2
Found 9 products.