CymitQuimica logo

CAS 877864-04-5

:

Ethanol, 2-[[2-[(tetrahydro-2H-pyran-2-yl)oxy]ethyl]dithio]-

Description:
Ethanol, 2-[[2-[(tetrahydro-2H-pyran-2-yl)oxy]ethyl]dithio]- is a chemical compound characterized by its unique structure that includes an ethanol backbone and a dithioether functional group. The presence of the tetrahydro-2H-pyran moiety contributes to its cyclic ether characteristics, which can influence its solubility and reactivity. This compound is likely to exhibit properties typical of both alcohols and thioethers, such as moderate polarity and potential for hydrogen bonding due to the hydroxyl group. Its dithioether component may impart specific reactivity, making it useful in various chemical applications, including synthesis and as a potential intermediate in organic chemistry. The compound's molecular structure suggests it may have applications in pharmaceuticals or materials science, although specific uses would depend on further research into its biological activity and stability. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.
Formula:C9H18O3S2
InChI:InChI=1S/C9H18O3S2/c10-4-7-13-14-8-6-12-9-3-1-2-5-11-9/h9-10H,1-8H2
InChI key:HUXQKDXLBYDKAK-UHFFFAOYSA-N
SMILES:C1CCOC(C1)OCCSSCCO
Found 4 products.