CymitQuimica logo

CAS 878010-24-3

:

morpholine-2-carboxylic acid hydrochloride

Description:
Morpholine-2-carboxylic acid hydrochloride, identified by its CAS number 878010-24-3, is a chemical compound that features a morpholine ring, which is a six-membered heterocyclic structure containing one nitrogen atom. This compound is characterized by the presence of a carboxylic acid functional group and a hydrochloride salt form, which enhances its solubility in water. Morpholine-2-carboxylic acid hydrochloride is typically a white to off-white crystalline solid, and it exhibits properties such as being hygroscopic. It is often used in pharmaceutical research and development due to its potential biological activity, including roles as a building block in the synthesis of various bioactive compounds. The compound's pH, stability, and reactivity can be influenced by the presence of the hydrochloride moiety, making it important to handle it under appropriate conditions. As with many chemical substances, safety precautions should be observed when handling morpholine-2-carboxylic acid hydrochloride, including the use of personal protective equipment to avoid exposure.
Formula:C5H10ClNO3
InChI:InChI=1S/C5H9NO3.ClH/c7-5(8)4-3-6-1-2-9-4;/h4,6H,1-3H2,(H,7,8);1H
InChI key:XLKJUXXMBJDEBH-UHFFFAOYSA-N
SMILES:C1COC(CN1)C(=O)O.Cl
Found 4 products.