CymitQuimica logo

CAS 87802-07-1

:

2-Benzothiazolecarboxylicacid, methyl ester

Description:
2-Benzothiazolecarboxylic acid, methyl ester, also known by its CAS number 87802-07-1, is an organic compound characterized by its benzothiazole structure, which consists of a benzene ring fused to a thiazole ring. This compound typically appears as a white to light yellow solid and is soluble in organic solvents such as ethanol and acetone, but has limited solubility in water. It is known for its potential applications in various fields, including pharmaceuticals, agrochemicals, and as a chemical intermediate. The presence of both carboxylic acid and ester functional groups in its structure contributes to its reactivity, allowing for further chemical modifications. Additionally, compounds of this nature may exhibit biological activity, making them of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H7NO2S
InChI:InChI=1S/C9H7NO2S/c1-12-9(11)8-10-6-4-2-3-5-7(6)13-8/h2-5H,1H3
InChI key:NGYIWFTZUHRKSF-UHFFFAOYSA-N
SMILES:COC(=O)C1=NC2=CC=CC=C2S1
Synonyms:
  • 2-Benzothiazolecarboxylicacid,methylester(9CI)
Found 4 products.