CAS 87802-11-7
:methyl 5-chloro-1H-indole-2-carboxylate
Description:
Methyl 5-chloro-1H-indole-2-carboxylate is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a chloro group at the 5-position and a carboxylate ester at the 2-position contributes to its unique reactivity and properties. This compound typically appears as a solid or liquid, depending on the specific conditions, and is often used in organic synthesis and medicinal chemistry due to its potential biological activity. It may exhibit properties such as moderate solubility in organic solvents and limited solubility in water, which is common for many indole derivatives. The chloro substituent can influence the compound's reactivity, making it a useful intermediate in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks if ingested or inhaled. Overall, methyl 5-chloro-1H-indole-2-carboxylate is a valuable compound in the field of organic chemistry.
Formula:C10H8ClNO2
InChI:InChI=1/C10H8ClNO2/c1-14-10(13)9-5-6-4-7(11)2-3-8(6)12-9/h2-5,12H,1H3
SMILES:COC(=O)c1cc2cc(ccc2[nH]1)Cl
Synonyms:- 1H-indole-2-carboxylic acid, 5-chloro-, methyl ester
- Methyl 5-chloro-1H-indole-2-carboxylate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Chloroindole-2-carboxylic acid methyl ester
CAS:Formula:C10H8ClNO2Purity:97%Color and Shape:SolidMolecular weight:209.62905-Chloro-1H-Indole-2-Carboxylic Acid Methyl Ester
CAS:5-Chloro-1H-Indole-2-Carboxylic Acid Methyl EsterPurity:97%Molecular weight:209.63g/mol5-Chloroindole-2-carboxylic acid methyl ester
CAS:5-Chloroindole-2-carboxylic acid methyl ester is a reagent and a building block for the synthesis of complex compounds. It has been used as an intermediate in the synthesis of various drugs, such as anti-inflammatory agents and antibiotics. 5-Chloroindole-2-carboxylic acid methyl ester has also been shown to be useful as a scaffold for the synthesis of natural products with biological activity.Formula:C10H8ClNO2Molecular weight:209.63 g/molRef: 3D-C-4625
1gTo inquire5gTo inquire250mgTo inquire500mgTo inquire2500mgTo inquire-Unit-ggTo inquire5-Chloroindole-2-carboxylic acid methyl ester
CAS:5-Chloroindole-2-carboxylic acid methyl ester is a potent inhibitor of the enzyme tyrosine kinase in cell culture, with an IC50 value of 0.5 nM. It has been shown to inhibit the growth of cancer cells (e.g., MDA-MB231, MCF-7) in vitro and in vivo. The IC50 values for inhibition of MDA-MB231 and MCF-7 cells are 0.1 and 10 nM, respectively. 5-Chloroindole-2-carboxylic acid methyl ester binds to the ATP binding site on tyrosine kinase, preventing ATP from binding and inhibiting phosphorylation of the receptor protein. This allows the receptor's downstream signaling pathways to be blocked, which leads to cell growth inhibition by arresting cell cycle progression at G0/G1 phase or inducing apoptosis.Formula:C10H8ClNO2Purity:Min. 95%Molecular weight:209.63 g/molMethyl 5-chloro-1H-indole-2-carboxylate
CAS:Formula:C10H8ClNO2Purity:98%Color and Shape:SolidMolecular weight:209.63



