CymitQuimica logo

CAS 878025-41-3

:

N-ethyl-5,6,7,8-tetrahydro-8-Quinolinamine

Description:
N-ethyl-5,6,7,8-tetrahydro-8-quinolinamine is a chemical compound characterized by its unique structure, which includes a quinoline ring system fused with a saturated tetrahydro moiety. This compound features an ethyl group attached to the nitrogen atom of the quinoline, contributing to its overall properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the amine functional group suggests potential basicity and reactivity, allowing it to participate in various chemical reactions, such as alkylation or acylation. Additionally, compounds of this class may exhibit biological activity, making them of interest in medicinal chemistry and drug development. The molecular structure can influence its pharmacokinetic properties, including absorption, distribution, metabolism, and excretion. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity. Overall, N-ethyl-5,6,7,8-tetrahydro-8-quinolinamine represents a compound with diverse applications in research and industry.
Formula:C11H16N2
InChI:InChI=1S/C11H16N2/c1-2-12-10-7-3-5-9-6-4-8-13-11(9)10/h4,6,8,10,12H,2-3,5,7H2,1H3
InChI key:NKBKRVWPGIIUGY-UHFFFAOYSA-N
SMILES:CCNC1CCCC2=C1N=CC=C2
Synonyms:
  • N-ethyl-5,6,7,8-tetrahydro-8-Quinolinamine
  • 8-Quinolinamine, N-ethyl-5,6,7,8-tetrahydro-
  • N-ethyl-5,6,7,8-tetrahydroquinolin-8-amine
Found 2 products.