CAS 87811-40-3

Formula: C13H16N4O5

InChI: InChI=1S/C13H16N4O5/c1-8(18)15-11(6-7-12(14)19)13(20)16-9-2-4-10(5-3-9)17(21)22/h2-5,11H,6-7H2,1H3,(H2,14,19)(H,15,18)(H,16,20)/t11-/m0/s1

InChI key: WCUDNXGWFVHMKG-NSHDSACASA-N

SMILES: CC(=O)N[C@@H](CCC(=O)N)C(=O)NC1=CC=C(C=C1)[N+](=O)[O-]

N-Acetyl-L-glutamine p-nitroanilide

CAS: 87811-40-3

N-Acetyl-L-glutamine p-nitroanilide is a fluorogenic substrate that can be used in the diagnosis of bacterial infections. It is a ligand that can bind to enzymes involved in the production of bioluminescence, such as luciferase, and can be used for the detection of bacteria. It is also used for food testing, environmental testing, and diagnostics. N-Acetyl-L-glutamine p-nitroanilide has high purity and high quality, which makes it suitable for conjugation with other molecules.

Formula: C₁₃H₁₅N₃O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 309.27 g/mol

Ref: 3D-EA31322