CymitQuimica logo

CAS 878111-18-3

:

Dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin, 4-hydroxy-2,6-bis(2,4,6-trimethylphenyl)-, 4-oxide, (11bS)-

Description:
Dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin, 4-hydroxy-2,6-bis(2,4,6-trimethylphenyl)-, 4-oxide, with CAS number 878111-18-3, is a complex organophosphorus compound characterized by its unique structural framework that includes a dioxaphosphepin core. This compound features multiple aromatic rings, specifically dinaphthyl moieties, which contribute to its stability and potential electronic properties. The presence of hydroxyl and trimethylphenyl substituents enhances its solubility and may influence its reactivity and interaction with other chemical species. As a phosphorus-containing compound, it may exhibit interesting properties such as potential applications in materials science, catalysis, or as a ligand in coordination chemistry. Its specific stereochemistry, indicated by the (11bS) designation, suggests a particular spatial arrangement that could affect its biological activity or interaction with other molecules. Overall, this compound represents a fascinating area of study within organophosphorus chemistry, with implications for both theoretical research and practical applications.
Formula:C38H33O4P
InChI:InChI=1S/C38H33O4P/c1-21-15-23(3)33(24(4)16-21)31-19-27-11-7-9-13-29(27)35-36-30-14-10-8-12-28(30)20-32(34-25(5)17-22(2)18-26(34)6)38(36)42-43(39,40)41-37(31)35/h7-20H,1-6H3,(H,39,40)
InChI key:InChIKey=BEHLZZISBCRGSO-UHFFFAOYSA-N
SMILES:O=P1(O)OC2=C(C3=C(C(=CC=4C3=CC=CC4)C5=C(C)C=C(C)C=C5C)O1)C=6C(C=C2C7=C(C)C=C(C)C=C7C)=CC=CC6
Synonyms:
  • Dinaphtho[2,1-d:1′,2′-f][1,3,2]dioxaphosphepin, 4-hydroxy-2,6-bis(2,4,6-trimethylphenyl)-, 4-oxide, (11bS)-
Found 4 products.