CymitQuimica logo

CAS 87813-72-7

:

6-{4-[(5-fluoro-1-benzofuran-2-yl)methyl]piperazin-1-yl}-N,N'-diprop-2-en-1-yl-1,3,5-triazine-2,4-diamine

Description:
The chemical substance known as "6-{4-[(5-fluoro-1-benzofuran-2-yl)methyl]piperazin-1-yl}-N,N'-diprop-2-en-1-yl-1,3,5-triazine-2,4-diamine" with CAS number 87813-72-7 is a complex organic compound characterized by its multi-functional structure. It features a triazine core, which is a six-membered ring containing three nitrogen atoms, contributing to its potential biological activity. The presence of a piperazine moiety suggests possible interactions with biological targets, particularly in medicinal chemistry. The fluorobenzofuran group enhances its lipophilicity and may influence its pharmacokinetic properties. The compound's alkenyl substituents indicate potential for further chemical reactivity, which could be exploited in synthetic applications or drug development. Overall, this compound's unique structural features may confer specific biological activities, making it of interest in pharmaceutical research, particularly in the development of novel therapeutic agents. Its properties, including solubility, stability, and reactivity, would be essential for determining its practical applications in various fields, including medicinal chemistry and materials science.
Formula:C22H26FN7O
InChI:InChI=1/C22H26FN7O/c1-3-7-24-20-26-21(25-8-4-2)28-22(27-20)30-11-9-29(10-12-30)15-18-14-16-13-17(23)5-6-19(16)31-18/h3-6,13-14H,1-2,7-12,15H2,(H2,24,25,26,27,28)
InChI key:JNMQZCSUWHRWIW-UHFFFAOYSA-N
SMILES:C=CCNC1=NC(=NC(=N1)N2CCN(CC2)CC3=CC4=C(O3)C=CC(=C4)F)NCC=C
Found 1 products.