CymitQuimica logo

CAS 87815-77-8

:

Benzoic acid, 4-(cyclohexylamino)-3-nitro-, ethyl ester

Description:
Benzoic acid, 4-(cyclohexylamino)-3-nitro-, ethyl ester, identified by the CAS number 87815-77-8, is an organic compound characterized by its ester functional group, which is derived from benzoic acid. This compound features a cyclohexylamino group and a nitro substituent at specific positions on the benzene ring, contributing to its unique chemical properties. Typically, it appears as a solid or liquid depending on the specific conditions, and it is likely to be soluble in organic solvents due to its ester nature. The presence of the nitro group introduces potential for reactivity, particularly in electrophilic substitution reactions. Additionally, the cyclohexylamino moiety may influence the compound's biological activity and solubility profile. As with many organic compounds, safety precautions should be taken when handling this substance, as it may pose health risks or environmental hazards. Overall, its structural features suggest potential applications in pharmaceuticals or agrochemicals, although specific uses would depend on further research and development.
Formula:C15H20N2O4
InChI:InChI=1S/C15H20N2O4/c1-2-21-15(18)11-8-9-13(14(10-11)17(19)20)16-12-6-4-3-5-7-12/h8-10,12,16H,2-7H2,1H3
InChI key:PALYDABJRIWMKF-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC(=C(C=C1)NC2CCCCC2)[N+](=O)[O-]
Found 4 products.