CymitQuimica logo

CAS 878194-91-3

:

4-Cyanopyridine-3-boronic acid pinacol ester

Description:
4-Cyanopyridine-3-boronic acid pinacol ester is an organoboron compound characterized by the presence of a boronic acid moiety and a cyanopyridine structure. This compound typically appears as a white to off-white solid and is soluble in common organic solvents such as dichloromethane and ethanol. It features a boron atom bonded to a pinacol ester, which enhances its stability and reactivity in various chemical reactions, particularly in Suzuki coupling reactions, where it serves as a valuable building block for the synthesis of biaryl compounds. The presence of the cyano group contributes to its electronic properties, making it a useful intermediate in organic synthesis. Additionally, this compound may exhibit moderate to low toxicity, necessitating appropriate safety precautions during handling. Its applications extend to medicinal chemistry and materials science, where it can be utilized in the development of pharmaceuticals and functional materials. As with many boronic acids, it is sensitive to moisture and should be stored in a dry environment to maintain its integrity.
Formula:C12H15BN2O2
InChI:InChI=1/C12H15BN2O2/c1-11(2)12(3,4)17-13(16-11)10-8-15-6-5-9(10)7-14/h5-6,8H,1-4H3
InChI key:DQQFRFWEPQBNEN-UHFFFAOYSA-N
SMILES:CC1(C)C(C)(C)OB(c2cnccc2C#N)O1
Synonyms:
  • 4-Cyano-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
  • Isonicotinonitrile-3-boronic acid pinacol ester
  • T6Nj Dcn C- Bt5Obotj D1 D1 E1 E1
  • 3-(4,4,5,5-Tetramethyl-1,3,2-Dioxaborolan-2-Yl)Pyridine-4-Carbonitrile
Found 4 products.