CymitQuimica logo

CAS 878207-28-4

:

methyl 2-bromo-4,5-difluoro-benzoate

Description:
Methyl 2-bromo-4,5-difluoro-benzoate is an organic compound characterized by its aromatic structure, which includes a benzoate moiety substituted with bromine and fluorine atoms. The presence of the bromine atom at the 2-position and two fluorine atoms at the 4 and 5 positions on the benzene ring contributes to its unique reactivity and physical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is soluble in organic solvents such as dichloromethane and ethyl acetate, but has limited solubility in water due to its hydrophobic aromatic structure. Methyl 2-bromo-4,5-difluoro-benzoate can be utilized in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in synthetic organic chemistry, particularly in the development of pharmaceuticals and agrochemicals. Its specific reactivity is influenced by the electronegative fluorine atoms, which can stabilize certain intermediates during chemical transformations.
Formula:C8H5BrF2O2
InChI:InChI=1/C8H5BrF2O2/c1-13-8(12)4-2-6(10)7(11)3-5(4)9/h2-3H,1H3
InChI key:ZCGAVEFBZYWYJW-UHFFFAOYSA-N
SMILES:COC(=O)c1cc(c(cc1Br)F)F
Synonyms:
  • Benzoic Acid, 2-Bromo-4,5-Difluoro-, Methyl Ester
  • Methyl 2-Bromo-4,5-Difluorobenzoate
Found 4 products.