CymitQuimica logo

CAS 87821-99-6

:

2-Cyclohexen-1-one, 5-(3,4-dimethylphenyl)-3-hydroxy-2-(1-oxobutyl)-

Description:
2-Cyclohexen-1-one, 5-(3,4-dimethylphenyl)-3-hydroxy-2-(1-oxobutyl)-, with the CAS number 87821-99-6, is an organic compound characterized by its complex structure, which includes a cyclohexene ring and various functional groups. This compound features a ketone group, a hydroxyl group, and a substituted phenyl group, contributing to its potential reactivity and biological activity. The presence of the cyclohexene moiety suggests that it may exhibit unique stereochemical properties and could participate in various chemical reactions, such as electrophilic additions or substitutions. The dimethylphenyl substitution may enhance its lipophilicity, influencing its solubility and interaction with biological systems. Additionally, the compound's structure indicates potential applications in pharmaceuticals or as a synthetic intermediate in organic chemistry. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require experimental determination or literature reference for precise values. Overall, this compound exemplifies the diversity of organic molecules and their potential utility in various chemical and biological contexts.
Formula:C18H22O3
InChI:InChI=1S/C18H22O3/c1-4-5-15(19)18-16(20)9-14(10-17(18)21)13-7-6-11(2)12(3)8-13/h6-8,14,19H,4-5,9-10H2,1-3H3
InChI key:FVBZLSAQBGMNMC-UHFFFAOYSA-N
SMILES:CCCC(=C1C(=O)CC(CC1=O)C2=CC(=C(C=C2)C)C)O
Found 1 products.