CAS 878232-99-6

2(1H)-Pyridinone, 4-[(1-methyl-3-phenylpropylidene)hydrazino]-

Description:

2(1H)-Pyridinone, 4-[(1-methyl-3-phenylpropylidene)hydrazino]- is a chemical compound characterized by its pyridinone core, which features a nitrogen-containing heterocyclic structure. This compound includes a hydrazine functional group, which is indicative of its potential reactivity and biological activity. The presence of the 1-methyl-3-phenylpropylidene substituent suggests that it may exhibit significant steric and electronic properties, potentially influencing its interactions in biological systems. The compound's structure may allow for hydrogen bonding and other intermolecular interactions, which can affect its solubility and stability. Additionally, the presence of both hydrazine and pyridinone functionalities may confer unique pharmacological properties, making it of interest in medicinal chemistry. Its CAS number, 878232-99-6, allows for precise identification and retrieval of information regarding its synthesis, properties, and applications in scientific literature. Overall, this compound represents a complex structure with potential implications in various fields, including pharmaceuticals and materials science.

Formula: C₁₅H₁₇N₃O

InChI: InChI=1S/C15H17N3O/c1-12(7-8-13-5-3-2-4-6-13)17-18-14-9-10-16-15(19)11-14/h2-6,9-11H,7-8H2,1H3,(H2,16,18,19)

InChI key: AZAPZQDVFYTHIM-UHFFFAOYSA-N

SMILES: CC(=NNC1=CC(=O)NC=C1)CCC2=CC=CC=C2

2(1H)-Pyridinone, 4-[(1-methyl-3-phenylpropylidene)hydrazino]-

CAS: 878232-99-6

Formula: C₁₅H₁₇N₃O

Molecular weight: 255.315

Ref: IN-DA004EO7