CAS 87830-59-9

Adenosine, 5'-deoxy-5'-(di-2-propenylamino)-

Description:

Adenosine, 5'-deoxy-5'-(di-2-propenylamino)-, identified by its CAS number 87830-59-9, is a modified nucleoside derivative of adenosine. This compound features a deoxy sugar moiety and a unique di-2-propenylamino substituent at the 5' position, which contributes to its distinct chemical properties. The presence of the di-2-propenylamino group suggests potential reactivity and biological activity, possibly influencing interactions with various biological targets. The structural modifications may enhance its lipophilicity, potentially affecting its permeability across biological membranes. As a nucleoside analog, it may exhibit properties relevant to pharmacology, including potential roles in cellular signaling or as a therapeutic agent. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its stability, solubility, and reactivity would be of interest in both research and application contexts. Further studies would be necessary to elucidate its specific biological functions and potential applications in medicinal chemistry or biochemistry.

Formula: C₁₆H₂₂N₆O₃

InChI: InChI=1S/C16H22N6O3/c1-3-5-21(6-4-2)7-10-12(23)13(24)16(25-10)22-9-20-11-14(17)18-8-19-15(11)22/h3-4,8-10,12-13,16,23-24H,1-2,5-7H2,(H2,17,18,19)/t10-,12-,13-,16-/m1/s1

InChI key: XPDOFYNLWCCBSS-XNIJJKJLSA-N

SMILES: C=CCN(CC=C)C[C@@H]1[C@H]([C@H]([C@@H](O1)N2C=NC3=C(N=CN=C32)N)O)O

Adenosine, 5'-deoxy-5'-(di-2-propenylamino)-

CAS: 87830-59-9

Formula: C₁₆H₂₂N₆O₃

Molecular weight: 346.3843

Ref: IN-DA004ENQ