CymitQuimica logo

CAS 87839-68-7

:

1,2,4,5-Tetrazine, 1,4-dihydro-3,6-dimethyl-1,4-diphenyl-

Description:
1,2,4,5-Tetrazine, 1,4-dihydro-3,6-dimethyl-1,4-diphenyl- (CAS 87839-68-7) is a heterocyclic organic compound characterized by its tetrazine ring structure, which consists of four nitrogen atoms and two carbon atoms. This compound features a dihydro form, indicating the presence of two hydrogen atoms that contribute to its stability. The presence of two methyl groups at the 3 and 6 positions, along with two phenyl groups at the 1 and 4 positions, enhances its aromatic character and may influence its reactivity and solubility. Generally, tetrazines are known for their potential applications in energetic materials and as precursors in organic synthesis due to their ability to undergo various chemical transformations. The compound may exhibit properties such as moderate thermal stability and specific reactivity patterns typical of nitrogen-rich heterocycles. Its unique structure and functional groups make it of interest in fields such as materials science and medicinal chemistry, although specific applications may vary based on further research and development.
Formula:C16H16N4
InChI:InChI=1S/C16H16N4/c1-13-17-20(16-11-7-4-8-12-16)14(2)18-19(13)15-9-5-3-6-10-15/h3-12H,1-2H3
InChI key:GQQNQWZTTDASCK-UHFFFAOYSA-N
SMILES:CC1=NN(C(=NN1C2=CC=CC=C2)C)C3=CC=CC=C3
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.