CAS 878437-11-7

4-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid

Description:

4-(3-Pyridin-3-yl-1,2,4-oxadiazol-5-yl)butanoic acid is a chemical compound characterized by its unique structure, which includes a butanoic acid moiety linked to a pyridine and an oxadiazole ring. This compound typically exhibits properties such as moderate solubility in polar solvents due to the presence of the carboxylic acid functional group, while the aromatic and heterocyclic components may contribute to its lipophilicity. The oxadiazole ring is known for its potential biological activity, often associated with antimicrobial and anti-inflammatory properties. The pyridine ring can enhance the compound's interaction with biological targets, making it of interest in medicinal chemistry. Additionally, the compound may exhibit specific reactivity patterns due to the functional groups present, allowing for further derivatization or modification. Its molecular weight, melting point, and spectral characteristics (such as NMR and IR) would provide further insights into its physical and chemical behavior, which are essential for applications in pharmaceuticals or materials science.

Formula: C₁₁H₁₁N₃O₃

InChI: InChI=1/C11H11N3O3/c15-10(16)5-1-4-9-13-11(14-17-9)8-3-2-6-12-7-8/h2-3,6-7H,1,4-5H2,(H,15,16)

InChI key: YRXOIZROPWIKJE-UHFFFAOYSA-N

SMILES: C(Cc1nc(c2cccnc2)no1)CC(=O)O

Synonyms:

• 1,2,4-Oxadiazole-5-Butanoic Acid, 3-(3-Pyridinyl)-

4-(3-(Pyridin-3-yl)-1,2,4-oxadiazol-5-yl)butanoic acid

CAS: 878437-11-7

Formula: C₁₁H₁₁N₃O₃

Molecular weight: 233.2233

Ref: IN-DA008CL0