CAS 87844-59-5

1H-Pyrazole, 3,4,5-tribromo-1-[(diethoxyphosphinothioyl)oxy]-

Description:

1H-Pyrazole, 3,4,5-tribromo-1-[(diethoxyphosphinothioyl)oxy]- is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two adjacent nitrogen atoms. The presence of three bromine atoms at the 3, 4, and 5 positions of the pyrazole ring significantly enhances its reactivity and may impart specific biological activities. The compound also features a diethoxyphosphinothioyl group, which suggests potential applications in agrochemicals or pharmaceuticals, particularly in the development of pesticides or herbicides due to the phosphorous and sulfur functionalities. The diethoxy groups can enhance solubility and bioavailability, while the thioyl moiety may contribute to the compound's reactivity. Overall, this compound's unique structure and substituents indicate that it may exhibit interesting chemical properties and biological activities, making it a subject of interest in synthetic chemistry and material science. However, specific safety and handling guidelines should be followed due to the presence of bromine and phosphorous, which can pose health and environmental risks.

Formula: C₇H₁₀Br₃N₂O₃PS

InChI: InChI=1S/C7H10Br3N2O3PS/c1-3-13-16(17,14-4-2)15-12-7(10)5(8)6(9)11-12/h3-4H2,1-2H3

InChI key: MOBOWMVIYVRKCB-UHFFFAOYSA-N

SMILES: CCOP(=S)(OCC)ON1C(=C(C(=N1)Br)Br)Br

1H-Pyrazole, 3,4,5-tribromo-1-[(diethoxyphosphinothioyl)oxy]-

CAS: 87844-59-5

Formula: C₇H₁₀Br₃N₂O₃PS

Molecular weight: 472.9167

Ref: IN-DA004EL7