CAS 87844-63-1

1H-Pyrazole, 4-chloro-1-[(diethoxyphosphinothioyl)oxy]-

Description:

1H-Pyrazole, 4-chloro-1-[(diethoxyphosphinothioyl)oxy]- is a chemical compound characterized by its unique structure, which includes a pyrazole ring substituted at the 4-position with a chlorine atom and a diethoxyphosphinothioyl group. This compound is notable for its potential applications in agricultural chemistry, particularly as a pesticide or herbicide, due to the presence of the phosphinothioyl moiety, which can enhance biological activity. The diethoxy groups contribute to its solubility and reactivity, making it suitable for various formulations. The presence of the chlorine atom can also influence the compound's stability and interaction with biological targets. As with many organophosphorus compounds, safety and handling precautions are essential, as they may exhibit toxicity to non-target organisms. Overall, this compound represents a class of chemicals that are of interest for their functional properties in synthetic and applied chemistry.

Formula: C₇H₁₂ClN₂O₃PS

InChI: InChI=1S/C7H12ClN2O3PS/c1-3-11-14(15,12-4-2)13-10-6-7(8)5-9-10/h5-6H,3-4H2,1-2H3

InChI key: DSSNDIKRMIUKCK-UHFFFAOYSA-N

SMILES: CCOP(=S)(OCC)ON1C=C(C=N1)Cl

1H-Pyrazole, 4-chloro-1-[(diethoxyphosphinothioyl)oxy]-

CAS: 87844-63-1

Formula: C₇H₁₂ClN₂O₃PS

Molecular weight: 270.6735

Ref: IN-DA004EL6