CAS 87846-95-5

Methyl 2,4,6-trimethoxy-5-pyrimidinecarboxylate

Description:

Methyl 2,4,6-trimethoxy-5-pyrimidinecarboxylate is an organic compound characterized by its pyrimidine ring structure, which is substituted with three methoxy groups and a carboxylate functional group. This compound typically exhibits properties associated with both aromatic and aliphatic compounds due to the presence of the pyrimidine ring and the ester functional group. It is likely to be a pale yellow to colorless liquid or solid, depending on its physical state at room temperature. The methoxy groups contribute to its solubility in organic solvents and may influence its reactivity and interaction with other chemical species. Methyl 2,4,6-trimethoxy-5-pyrimidinecarboxylate may also exhibit biological activity, making it of interest in pharmaceutical research. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of compounds with specific biological targets. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₉H₁₂N₂O₅

InChI: InChI=1S/C9H12N2O5/c1-13-6-5(8(12)15-3)7(14-2)11-9(10-6)16-4/h1-4H3

InChI key: InChIKey=DZIRFGZEMFCCKG-UHFFFAOYSA-N

SMILES: C(OC)(=O)C=1C(OC)=NC(OC)=NC1OC

Synonyms:

• 5-Pyrimidinecarboxylic acid, 2,4,6-trimethoxy-, methyl ester
• Methyl 2,4,6-trimethoxy-5-pyrimidinecarboxylate

5-Pyrimidinecarboxylic acid, 2,4,6-trimethoxy-, methyl ester

CAS: 87846-95-5

Formula: C₉H₁₂N₂O₅

Molecular weight: 228.202

Ref: IN-DA004EL5