CAS 87848-67-7

2-Cyclohexen-1-one, 6-(3-hydroxy-1-methylpropyl)-3-methyl-

Description:

2-Cyclohexen-1-one, 6-(3-hydroxy-1-methylpropyl)-3-methyl- is an organic compound characterized by its cyclic structure and the presence of a conjugated carbonyl group. This compound features a cyclohexene ring, which is a six-membered carbon ring with one double bond, contributing to its unsaturation. The presence of a ketone functional group (the carbonyl) at the 1-position and various substituents, including a hydroxy group and an alkyl chain, adds to its complexity and potential reactivity. The hydroxy group can participate in hydrogen bonding, influencing the compound's solubility and reactivity in various solvents. Additionally, the methyl groups and the branched alkyl chain can affect the steric hindrance and electronic properties of the molecule, potentially impacting its behavior in chemical reactions. This compound may be of interest in synthetic organic chemistry and could have applications in the development of pharmaceuticals or agrochemicals, although specific applications would depend on further research into its properties and reactivity.

Formula: C₁₁H₁₈O₂

InChI: InChI=1S/C11H18O2/c1-8-3-4-10(11(13)7-8)9(2)5-6-12/h7,9-10,12H,3-6H2,1-2H3

InChI key: SIORYLZESGPBAU-UHFFFAOYSA-N

SMILES: CC1=CC(=O)C(CC1)C(C)CCO

2-Cyclohexen-1-one, 6-(3-hydroxy-1-methylpropyl)-3-methyl-

CAS: 87848-67-7

Formula: C₁₁H₁₈O₂

Molecular weight: 182.2594

Ref: IN-DA004EKU