CAS 87849-90-9

1(2H)-Phthalazinone, 4-(1-naphthalenylmethyl)-

Description:

1(2H)-Phthalazinone, 4-(1-naphthalenylmethyl)-, identified by CAS number 87849-90-9, is an organic compound characterized by its phthalazinone core structure, which is a bicyclic compound featuring a fused benzene and pyrazine ring. This compound exhibits a naphthalenylmethyl substituent at the 4-position, contributing to its unique chemical properties. Typically, phthalazinones are known for their potential biological activities, including antimicrobial and anti-inflammatory effects. The presence of the naphthyl group may enhance its lipophilicity, influencing its solubility and interaction with biological membranes. In terms of physical properties, compounds of this class often display moderate to high melting points and may be crystalline in nature. The compound's reactivity can be attributed to the functional groups present, allowing for various chemical transformations. Overall, 1(2H)-Phthalazinone, 4-(1-naphthalenylmethyl)- is of interest in medicinal chemistry and material science due to its structural features and potential applications.

Formula: C₁₉H₁₄N₂O

InChI: InChI=1S/C19H14N2O/c22-19-17-11-4-3-10-16(17)18(20-21-19)12-14-8-5-7-13-6-1-2-9-15(13)14/h1-11H,12H2,(H,21,22)

InChI key: ZKLZDGAZFKPCCL-UHFFFAOYSA-N

SMILES: C1=CC=C2C(=C1)C=CC=C2CC3=NNC(=O)C4=CC=CC=C43

4-(Naphthalen-1-ylmethyl)phthalazin-1(2H)-one

CAS: 87849-90-9

Formula: C₁₉H₁₄N₂O

Molecular weight: 286.3273

Ref: IN-DA004EGC