CAS 87866-87-3

1H-Indol-1-amine, N-[(9-ethyl-9H-carbazol-3-yl)methylene]-2,3-dihydro-

Description:

1H-Indol-1-amine, N-[(9-ethyl-9H-carbazol-3-yl)methylene]-2,3-dihydro- is a chemical compound characterized by its complex structure, which includes an indole moiety and a carbazole derivative. This compound typically exhibits properties associated with both indole and carbazole, such as potential fluorescence and biological activity. It may possess a range of functional groups that contribute to its reactivity and solubility in various solvents. The presence of the indole and carbazole structures suggests that it could have applications in organic electronics, pharmaceuticals, or as a dye. The compound's molecular weight, melting point, and solubility characteristics would depend on its specific structural features and substituents. Additionally, it may exhibit interesting interactions with biological systems, making it a candidate for further research in medicinal chemistry. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₂₃H₂₁N₃

InChI: InChI=1S/C23H21N3/c1-2-25-22-10-6-4-8-19(22)20-15-17(11-12-23(20)25)16-24-26-14-13-18-7-3-5-9-21(18)26/h3-12,15-16H,2,13-14H2,1H3

InChI key: ROCPSBKCZCDEJI-UHFFFAOYSA-N

SMILES: CCN1C2=C(C=C(C=C2)C=NN3CCC4=CC=CC=C43)C5=CC=CC=C51

1H-Indol-1-amine, N-[(9-ethyl-9H-carbazol-3-yl)methylene]-2,3-dihydro-

CAS: 87866-87-3

Formula: C₂₃H₂₁N₃

Molecular weight: 339.4329

Ref: IN-DA004EE2