CymitQuimica logo

CAS 878671-96-6

:

3H-1,2,4-Triazole-3-thione, 5-amino-4-(4-cyclopropyl-1-naphthalenyl)-2,4-dihydro-

Description:
3H-1,2,4-Triazole-3-thione, 5-amino-4-(4-cyclopropyl-1-naphthalenyl)-2,4-dihydro- is a chemical compound characterized by its triazole ring structure, which is a five-membered heterocyclic compound containing three nitrogen atoms. This compound features a thione functional group, indicating the presence of a sulfur atom double-bonded to a carbon atom, contributing to its reactivity and potential biological activity. The presence of an amino group enhances its ability to participate in hydrogen bonding, which can influence its solubility and interaction with biological targets. The cyclopropyl and naphthalene moieties suggest that the compound may exhibit unique steric and electronic properties, potentially affecting its pharmacological profile. This compound may be of interest in medicinal chemistry due to its structural features, which could lead to applications in drug development, particularly in areas targeting specific biological pathways. As with many heterocycles, the stability and reactivity of this compound can be influenced by environmental conditions such as pH and temperature.
Formula:C15H14N4S
InChI:InChI=1S/C15H14N4S/c16-14-17-18-15(20)19(14)13-8-7-10(9-5-6-9)11-3-1-2-4-12(11)13/h1-4,7-9H,5-6H2,(H2,16,17)(H,18,20)
InChI key:VHPOGQZYQNLNNN-UHFFFAOYSA-N
SMILES:C1CC1C2=CC=C(C3=CC=CC=C23)N4C(=NNC4=S)N
Synonyms:
  • 5-Amino-4-(4-cyclopropyl-1-naphthalenyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione
  • 5-Amino-4-(4-cyclopropylnaphthalen-1-yl)-4H-[1,2,4]triazole-3-thiol
  • 3-Amino-4-(4-cyclopropylnaphthalen-1-yl)-4H-1,2,4-triazole-5-thiol
Found 3 products.