CymitQuimica logo

CAS 878680-54-7

:

5-(azepan-1-ylmethyl)furan-2-carboxylic acid

Description:
5-(Azepan-1-ylmethyl)furan-2-carboxylic acid is a chemical compound characterized by its unique structure, which includes a furan ring and an azepane moiety. The presence of the furan ring contributes to its aromatic properties, while the carboxylic acid functional group imparts acidic characteristics, making it capable of participating in various chemical reactions, such as esterification and amidation. The azepane group, a seven-membered saturated nitrogen-containing ring, adds to the compound's potential for biological activity and interaction with biological systems. This compound may exhibit solubility in polar solvents due to the carboxylic acid group, while the furan and azepane components can influence its lipophilicity. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, where it may serve as a scaffold for drug design. Overall, the combination of its functional groups and ring structures makes 5-(azepan-1-ylmethyl)furan-2-carboxylic acid a compound of interest in both synthetic and medicinal chemistry.
Formula:C12H17NO3
InChI:InChI=1/C12H17NO3/c14-12(15)11-6-5-10(16-11)9-13-7-3-1-2-4-8-13/h5-6H,1-4,7-9H2,(H,14,15)
InChI key:OENIIOJDDXNNDW-UHFFFAOYSA-N
SMILES:C1CCCN(CC1)Cc1ccc(C(=O)O)o1
Synonyms:
  • 2-furancarboxylic acid, 5-[(hexahydro-1H-azepin-1-yl)methyl]-
Found 1 products.