CAS 87869-68-9

1-Propen-1-amine, N-[1-(3-methylphenyl)ethylidene]-, (E,E)-

Description:

1-Propen-1-amine, N-[1-(3-methylphenyl)ethylidene]-, (E,E)-, also known by its CAS number 87869-68-9, is an organic compound characterized by its amine functional group and an alkenyl structure. This compound features a propenyl group attached to a nitrogen atom, which is further connected to a substituted ethylidene moiety containing a 3-methylphenyl group. The (E,E) designation indicates the configuration of the double bonds in the molecule, suggesting that both double bonds are in the trans (E) configuration. This structural arrangement can influence the compound's reactivity and physical properties, such as boiling point and solubility. Generally, compounds of this type may exhibit properties typical of amines, including basicity and potential for hydrogen bonding. They may also participate in various chemical reactions, including nucleophilic additions and polymerization processes. The presence of the aromatic ring can contribute to the compound's stability and influence its interactions with other chemical species. Overall, this compound's unique structure suggests potential applications in organic synthesis and materials science.

Formula: C₁₂H₁₅N

InChI: InChI=1S/C12H15N/c1-4-8-13-11(3)12-7-5-6-10(2)9-12/h4-9H,1-3H3/b8-4+,13-11?

InChI key: WKRVWOBQEVBXKQ-ORDNDCRFSA-N

SMILES: C/C=C/N=C(C)C1=CC=CC(=C1)C

1-Propen-1-amine, N-[1-(3-methylphenyl)ethylidene]-, (E,E)-

CAS: 87869-68-9

Formula: C₁₂H₁₅N

Molecular weight: 173.2542

Ref: IN-DA004EDS