CAS 87871-34-9

Benzamide, 4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1(2H)-yl)-

Description:

Benzamide, 4-(4,6-diamino-2,2-dimethyl-1,3,5-triazin-1(2H)-yl)-, is a chemical compound characterized by its structural features that include a benzamide moiety and a triazine ring. The presence of the benzamide group suggests that it has properties typical of amides, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding. The triazine component, particularly with amino substituents, indicates that this compound may exhibit biological activity, possibly as a herbicide or in other agricultural applications. The presence of multiple amino groups can enhance its reactivity and interaction with biological targets. Additionally, the dimethyl substitution on the triazine ring may influence its steric properties and overall stability. Overall, this compound's unique structure suggests a combination of chemical reactivity and potential utility in various fields, including pharmaceuticals and agrochemicals. However, specific physical properties such as melting point, boiling point, and solubility would require empirical data for precise characterization.

Formula: C₁₂H₁₆N₆O

InChI: InChI=1S/C12H16N6O/c1-12(2)17-10(14)16-11(15)18(12)8-5-3-7(4-6-8)9(13)19/h3-6H,1-2H3,(H2,13,19)(H4,14,15,16,17)

InChI key: MCGQISHBXJFQSB-UHFFFAOYSA-N

SMILES: CC1(N=C(N=C(N1C2=CC=C(C=C2)C(=O)N)N)N)C

4-(4,6-Diamino-2,2-dimethyl-1,3,5-triazin-1(2H)-yl)benzamide

CAS: 87871-34-9

Formula: C₁₂H₁₆N₆O

Molecular weight: 260.295

Ref: IN-DA004E9C