CymitQuimica logo

CAS 878742-59-7

:

2-(Trifluoromethyl)pyrimidine-4-carboxylic acid

Description:
2-(Trifluoromethyl)pyrimidine-4-carboxylic acid is a heterocyclic organic compound characterized by the presence of a pyrimidine ring substituted with a trifluoromethyl group and a carboxylic acid functional group. The trifluoromethyl group (-CF3) is known for its electron-withdrawing properties, which can significantly influence the compound's reactivity and stability. The carboxylic acid group (-COOH) contributes to the compound's acidity and can participate in various chemical reactions, such as esterification and amidation. This compound is typically used in pharmaceutical research and development due to its potential biological activity and ability to serve as a building block for more complex molecules. Its unique structural features may also impart specific properties, such as solubility in polar solvents and the ability to form hydrogen bonds, which can be crucial for interactions with biological targets. Overall, 2-(Trifluoromethyl)pyrimidine-4-carboxylic acid is a valuable compound in the field of medicinal chemistry and materials science.
Formula:C6H3F3N2O2
InChI:InChI=1/C6H3F3N2O2/c7-6(8,9)5-10-2-1-3(11-5)4(12)13/h1-2H,(H,12,13)
InChI key:HGFBZPMMYNDNLR-UHFFFAOYSA-N
SMILES:c1cnc(C(F)(F)F)nc1C(=O)O
Synonyms:
  • 4-Pyrimidinecarboxylic Acid, 2-(Trifluoromethyl)-
  • 2-(trifluoromethyl)pyrimidine-4-carboxylic acid
Found 4 products.