CAS 87875-57-8

2-Cyclohexen-1-one, 3,3'-[1,4-butanediylbis(oxy)]bis[5,5-dimethyl-

Description:

2-Cyclohexen-1-one, 3,3'-[1,4-butanediylbis(oxy)]bis[5,5-dimethyl-] is an organic compound characterized by its unique structure, which includes a cyclohexene ring and ether linkages due to the butanediyl groups. This compound features a conjugated system with a carbonyl group, contributing to its reactivity and potential applications in organic synthesis. The presence of dimethyl groups enhances steric hindrance and may influence its physical properties, such as boiling point and solubility. Typically, compounds of this nature can exhibit interesting chemical behavior, including potential for electrophilic addition reactions due to the unsaturation in the cyclohexene moiety. Additionally, the ether functionalities may impart solubility in polar solvents, making it versatile for various chemical applications. Overall, this compound's structural features suggest it could be of interest in fields such as medicinal chemistry, materials science, or as a synthetic intermediate. However, specific properties like melting point, boiling point, and reactivity would need to be determined experimentally or sourced from detailed chemical databases.

Formula: C₂₀H₃₀O₄

InChI: InChI=1S/C20H30O4/c1-19(2)11-15(21)9-17(13-19)23-7-5-6-8-24-18-10-16(22)12-20(3,4)14-18/h9-10H,5-8,11-14H2,1-4H3

InChI key: LALQVNNKHFBIRW-UHFFFAOYSA-N

SMILES: CC1(CC(=CC(=O)C1)OCCCCOC2=CC(=O)CC(C2)(C)C)C

2-Cyclohexen-1-one, 3,3'-[1,4-butanediylbis(oxy)]bis[5,5-dimethyl-

CAS: 87875-57-8

Formula: C₂₀H₃₀O₄

Molecular weight: 334.4498

Ref: IN-DA004E7P