CAS 878801-85-5

Quinoline, 4-[(1E)-2-(3,4-dimethoxyphenyl)ethenyl]-

Description:

Quinoline, 4-[(1E)-2-(3,4-dimethoxyphenyl)ethenyl]- is an organic compound characterized by its quinoline backbone, which is a bicyclic structure consisting of a benzene ring fused to a pyridine ring. This compound features a vinyl group attached to the 4-position of the quinoline, specifically a (1E)-2-(3,4-dimethoxyphenyl)ethenyl substituent, which introduces additional aromatic character and potential for various chemical interactions. The presence of methoxy groups on the phenyl ring enhances its electron-donating properties, potentially influencing its reactivity and solubility. Quinoline derivatives are known for their diverse biological activities, including antimicrobial and antitumor properties, making them of interest in medicinal chemistry. The compound's molecular structure suggests it may exhibit unique optical and electronic properties, which could be explored for applications in organic electronics or as fluorescent probes. Overall, this compound exemplifies the complexity and versatility of quinoline derivatives in both synthetic and applied chemistry contexts.

Formula: C₁₉H₁₇NO₂

InChI: InChI=1S/C19H17NO2/c1-21-18-10-8-14(13-19(18)22-2)7-9-15-11-12-20-17-6-4-3-5-16(15)17/h3-13H,1-2H3/b9-7+

InChI key: NFGZBGNIUGXLOT-VQHVLOKHSA-N

SMILES: COC1=C(C=C(C=C1)/C=C/C2=CC=NC3=CC=CC=C23)OC

Quinoline, 4-[(1E)-2-(3,4-dimethoxyphenyl)ethenyl]-

CAS: 878801-85-5

Formula: C₁₉H₁₇NO₂

Molecular weight: 291.3438

Ref: IN-DA004FXN