CAS 87884-45-5

Acetic acid, oxo[[6-(2-phenylethenyl)-2-pyridinyl]amino]-

Description:

Acetic acid, oxo[[6-(2-phenylethenyl)-2-pyridinyl]amino]- is a chemical compound characterized by its complex structure, which includes an acetic acid moiety and a pyridine ring substituted with a phenyl group. This compound features an amino group that connects the pyridine to the acetic acid, indicating potential for hydrogen bonding and interactions with other molecules. The presence of the phenylethenyl group suggests that it may exhibit unique electronic properties and reactivity, making it of interest in various chemical applications, including pharmaceuticals and organic synthesis. The compound's molecular structure contributes to its solubility in polar solvents, while its functional groups may influence its biological activity. As with many organic compounds, safety and handling precautions are essential, as it may exhibit toxicity or irritant properties. Overall, this compound exemplifies the diverse chemistry of acetic acid derivatives, which can serve as building blocks in the synthesis of more complex molecules.

Formula: C₁₅H₁₂N₂O₃

InChI: InChI=1S/C15H12N2O3/c18-14(15(19)20)17-13-8-4-7-12(16-13)10-9-11-5-2-1-3-6-11/h1-10H,(H,19,20)(H,16,17,18)

InChI key: JFXQQWORCOFNEK-UHFFFAOYSA-N

SMILES: C1=CC=C(C=C1)C=CC2=NC(=CC=C2)NC(=O)C(=O)O

Acetic acid, oxo[[6-(2-phenylethenyl)-2-pyridinyl]amino]-

CAS: 87884-45-5

Formula: C₁₅H₁₂N₂O₃

Molecular weight: 268.2674

Ref: IN-DA004FXG