CAS 87884-53-5

2-Pyrrolidinone, 1-methyl-4-(phenylthio)-

Description:

2-Pyrrolidinone, 1-methyl-4-(phenylthio)-, with the CAS number 87884-53-5, is an organic compound characterized by its pyrrolidinone ring structure, which is a five-membered lactam. This compound features a methyl group and a phenylthio substituent, contributing to its unique chemical properties. It is typically a colorless to pale yellow liquid or solid, depending on the specific conditions and purity. The presence of the phenylthio group enhances its reactivity and solubility in organic solvents, making it useful in various chemical applications, including as a reagent in organic synthesis. The compound may exhibit moderate to low toxicity, and safety precautions should be taken when handling it, as with many organic chemicals. Its applications may extend to pharmaceuticals, agrochemicals, or as an intermediate in the synthesis of other compounds. As with any chemical, understanding its properties, reactivity, and potential hazards is essential for safe and effective use in laboratory or industrial settings.

Formula: C₁₁H₁₃NOS

InChI: InChI=1S/C11H13NOS/c1-12-8-10(7-11(12)13)14-9-5-3-2-4-6-9/h2-6,10H,7-8H2,1H3

InChI key: ZYJLOQCLXAAMIN-UHFFFAOYSA-N

SMILES: CN1CC(CC1=O)SC2=CC=CC=C2

2-Pyrrolidinone, 1-methyl-4-(phenylthio)-

CAS: 87884-53-5

Formula: C₁₁H₁₃NOS

Molecular weight: 207.292

Ref: IN-DA004E77