CAS 87884-56-8

2H-Pyrrol-2-one, 1,5-dihydro-1-methyl-5-(phenylmethylene)-, (Z)-

Description:

2H-Pyrrol-2-one, 1,5-dihydro-1-methyl-5-(phenylmethylene)-, (Z)-, with the CAS number 87884-56-8, is an organic compound characterized by its pyrrolone structure, which features a five-membered ring containing both nitrogen and a carbonyl group. This compound exhibits a Z configuration, indicating that the substituents on the double bond are on the same side, which can influence its reactivity and interactions. It typically appears as a solid or liquid depending on the specific conditions and may have a distinct aromatic character due to the phenylmethylene group. The presence of the methyl and phenyl groups contributes to its hydrophobic nature, potentially affecting its solubility in various solvents. This compound may be of interest in synthetic organic chemistry and could have applications in pharmaceuticals or materials science, although specific applications would depend on further research into its properties and reactivity. As with many organic compounds, safety data should be consulted before handling, as it may pose health or environmental risks.

Formula: C₁₂H₁₁NO

InChI: InChI=1S/C12H11NO/c1-13-11(7-8-12(13)14)9-10-5-3-2-4-6-10/h2-9H,1H3

InChI key: NMAWFKGEZBEDRP-UHFFFAOYSA-N

SMILES: CN1C(=CC2=CC=CC=C2)C=CC1=O

2H-Pyrrol-2-one, 1,5-dihydro-1-methyl-5-(phenylmethylene)-, (Z)-

CAS: 87884-56-8

Formula: C₁₂H₁₁NO

Molecular weight: 185.2218

Ref: IN-DA004E76