CAS 87884-64-8

2H-Pyrrol-2-one, 5-(dihydro-2(3H)-furanylidene)-1,5-dihydro-1-methyl-

Description:

2H-Pyrrol-2-one, 5-(dihydro-2(3H)-furanylidene)-1,5-dihydro-1-methyl- is an organic compound characterized by its unique bicyclic structure, which includes a pyrrolone ring and a furan moiety. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents. Its molecular structure suggests potential reactivity due to the presence of both carbonyl and double bond functionalities, which may participate in various chemical reactions such as nucleophilic additions or cycloadditions. The presence of the dihydrofuran group may also impart interesting properties, including potential biological activity, making it of interest in medicinal chemistry. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as temperature and pH. Overall, 2H-Pyrrol-2-one derivatives are often studied for their applications in pharmaceuticals, agrochemicals, and as intermediates in organic synthesis.

Formula: C₉H₁₁NO₂

InChI: InChI=1S/C9H11NO2/c1-10-7(4-5-9(10)11)8-3-2-6-12-8/h4-5H,2-3,6H2,1H3

InChI key: SZZZBIGXFUPZEH-UHFFFAOYSA-N

SMILES: CN1C(=C2CCCO2)C=CC1=O

2H-Pyrrol-2-one, 5-(dihydro-2(3H)-furanylidene)-1,5-dihydro-1-methyl-

CAS: 87884-64-8

Formula: C₉H₁₁NO₂

Molecular weight: 165.1891

Ref: IN-DA004FXB