CymitQuimica logo

CAS 87887-19-2

:

2-Pentanol, 1-[(2,2,6,6-tetramethylcyclohexyl)oxy]-

Description:
2-Pentanol, 1-[(2,2,6,6-tetramethylcyclohexyl)oxy]- is an organic compound characterized by its structure, which includes a pentanol moiety and a bulky tetramethylcyclohexyl ether group. This compound is typically a colorless liquid with a distinctive odor. It is soluble in organic solvents and exhibits moderate polarity due to the presence of the hydroxyl (-OH) group. The bulky tetramethylcyclohexyl group contributes to its steric hindrance, which can influence its reactivity and interactions with other molecules. The compound may be used in various applications, including as a solvent or in the synthesis of other chemical entities. Its physical properties, such as boiling point and density, can vary based on the specific conditions and purity of the sample. Safety data should be consulted, as it may pose health risks if ingested or inhaled, and appropriate handling procedures should be followed. Overall, 2-Pentanol, 1-[(2,2,6,6-tetramethylcyclohexyl)oxy]- is a notable compound in organic chemistry with potential utility in various industrial applications.
Formula:C15H30O2
InChI:InChI=1S/C15H30O2/c1-6-8-12(16)11-17-13-14(2,3)9-7-10-15(13,4)5/h12-13,16H,6-11H2,1-5H3
InChI key:QXFGHYQLVXLTBF-UHFFFAOYSA-N
SMILES:CCCC(COC1C(CCCC1(C)C)(C)C)O
Found 1 products.