CAS 87887-43-2

Piperazine, 1-(diphenylmethyl)-4-pentyl-, ethanedioate

Description:

Piperazine, 1-(diphenylmethyl)-4-pentyl-, ethanedioate, identified by CAS number 87887-43-2, is a chemical compound that belongs to the piperazine class, which is characterized by a six-membered ring containing two nitrogen atoms. This specific compound features a diphenylmethyl group and a pentyl chain, contributing to its unique structural and functional properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. The ethanedioate moiety indicates the presence of an oxalic acid derivative, which can influence the compound's reactivity and potential applications. Piperazine derivatives are often studied for their pharmacological properties, including potential use in medicinal chemistry, due to their ability to interact with various biological targets. The presence of the diphenylmethyl and pentyl groups may enhance lipophilicity, affecting the compound's bioavailability and interaction with biological membranes. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₂₂H₃₀N₂xC₂H₂O₄

InChI: InChI=1S/C22H30N2.C2H2O4/c1-2-3-10-15-23-16-18-24(19-17-23)22(20-11-6-4-7-12-20)21-13-8-5-9-14-21;3-1(4)2(5)6/h4-9,11-14,22H,2-3,10,15-19H2,1H3;(H,3,4)(H,5,6)

InChI key: PSMMTUZDDHZTRJ-UHFFFAOYSA-N

SMILES: CCCCCN1CCN(CC1)C(C2=CC=CC=C2)C3=CC=CC=C3.C(=O)(C(=O)O)O

Piperazine, 1-(diphenylmethyl)-4-pentyl-, ethanedioate

CAS: 87887-43-2

Formula: C₂₄H₃₂N₂O₄

Molecular weight: 412.5219

Ref: IN-DA004E6W