CAS 87887-67-0

Piperazine, 1-(diphenylmethyl)-4-(2-phenoxyethyl)-, ethanedioate

Description:

Piperazine, 1-(diphenylmethyl)-4-(2-phenoxyethyl)-, ethanedioate, identified by CAS number 87887-67-0, is a chemical compound that belongs to the piperazine class, which is characterized by a six-membered ring containing two nitrogen atoms. This specific compound features a diphenylmethyl group and a phenoxyethyl substituent, contributing to its unique properties. It is typically a white to off-white solid and may exhibit moderate solubility in organic solvents. The presence of the ethanedioate moiety suggests that it may form salts or complexes, influencing its reactivity and potential applications. Piperazine derivatives are often studied for their biological activities, including potential pharmaceutical applications, due to their ability to interact with various biological targets. Safety and handling precautions should be observed, as with many chemical substances, to mitigate any risks associated with exposure. Overall, this compound's structural characteristics may lend it interesting properties for further research in medicinal chemistry and related fields.

Formula: C₂₅H₂₈N₂OxC₂H₂O₄

InChI: InChI=1S/C25H28N2O.C2H2O4/c1-4-10-22(11-5-1)25(23-12-6-2-7-13-23)27-18-16-26(17-19-27)20-21-28-24-14-8-3-9-15-24;3-1(4)2(5)6/h1-15,25H,16-21H2;(H,3,4)(H,5,6)

InChI key: CRMPZNSTPAHXRN-UHFFFAOYSA-N

SMILES: C1CN(CCN1CCOC2=CC=CC=C2)C(C3=CC=CC=C3)C4=CC=CC=C4.C(=O)(C(=O)O)O

Piperazine, 1-(diphenylmethyl)-4-(2-phenoxyethyl)-, ethanedioate

CAS: 87887-67-0

Formula: C₂₇H₃₀N₂O₅

Molecular weight: 462.5375

Ref: IN-DA004E6T